C33H42ClNO4 — CID 162245202
tert-butyl (4S)-7-chloro-5'-[[(1S,2R)-2-[(1R)-1-hydroxybut-3-enyl]-2-methylcyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate (PubChem CID 162245202) has the molecular formula C33H42ClNO4 and a molecular weight of 552.16 g/mol. Its IUPAC name is tert-butyl (4S)-7-chloro-5'-[[(1S,2R)-2-[(1R)-1-hydroxybut-3-enyl]-2-methylcyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate.
| Compound Name | tert-butyl (4S)-7-chloro-5'-[[(1S,2R)-2-[(1R)-1-hydroxybut-3-enyl]-2-methylcyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate |
|---|---|
| PubChem CID | 162245202 |
| Molecular Formula | C33H42ClNO4 |
| Molecular Weight | 552.16 g/mol |
| Exact Mass | 551.28 |
| IUPAC Name | tert-butyl (4S)-7-chloro-5'-[[(1S,2R)-2-[(1R)-1-hydroxybut-3-enyl]-2-methylcyclobutyl]methyl]spiro[2,3-dihydro-1H-naphthalene-4,3'-2,4-dihydro-1,5-benzoxazepine]-7'-carboxylate |
| SMILES | C=CC[C@@H](O)[C@]1(C)CC[C@@H]1CN1C[C@@]2(CCCc3cc(Cl)ccc32)COc2ccc(C(=O)OC(C)(C)C)cc21 |
| InChI | InChI=1S/C33H42ClNO4/c1-6-8-29(36)32(5)16-14-24(32)19-35-20-33(15-7-9-22-17-25(34)11-12-26(22)33)21-38-28-13-10-23(18-27(28)35)30(37)39-31(2,3)4/h6,10-13,17-18,24,29,36H,1,7-9,14-16,19-21H2,2-5H3/t24-,29-,32-,33+/m1/s1 |
| InChIKey | RDZYWZKHKJJORL-AUPUZEHNSA-N |
| XLogP | 7.12 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.16 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|