C26H23F5N3O7P — CID 146602002
[3-[[(4S)-3,4-dimethyl-2-oxo-7-[(2,4,6-trifluorophenyl)methylcarbamoyl]-4H-quinazolin-1-yl]methyl]-2,4-difluorophenoxy]methyl dihydrogen phosphate (PubChem CID 146602002) has the molecular formula C26H23F5N3O7P and a molecular weight of 615.45 g/mol. Its IUPAC name is [3-[[(4S)-3,4-dimethyl-2-oxo-7-[(2,4,6-trifluorophenyl)methylcarbamoyl]-4H-quinazolin-1-yl]methyl]-2,4-difluorophenoxy]methyl dihydrogen phosphate.
| Compound Name | [3-[[(4S)-3,4-dimethyl-2-oxo-7-[(2,4,6-trifluorophenyl)methylcarbamoyl]-4H-quinazolin-1-yl]methyl]-2,4-difluorophenoxy]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 146602002 |
| Molecular Formula | C26H23F5N3O7P |
| Molecular Weight | 615.45 g/mol |
| Exact Mass | 615.12 |
| IUPAC Name | [3-[[(4S)-3,4-dimethyl-2-oxo-7-[(2,4,6-trifluorophenyl)methylcarbamoyl]-4H-quinazolin-1-yl]methyl]-2,4-difluorophenoxy]methyl dihydrogen phosphate |
| SMILES | C[C@H]1c2ccc(C(=O)NCc3c(F)cc(F)cc3F)cc2N(Cc2c(F)ccc(OCOP(=O)(O)O)c2F)C(=O)N1C |
| InChI | InChI=1S/C26H23F5N3O7P/c1-13-16-4-3-14(25(35)32-10-17-20(29)8-15(27)9-21(17)30)7-22(16)34(26(36)33(13)2)11-18-19(28)5-6-23(24(18)31)40-12-41-42(37,38)39/h3-9,13H,10-12H2,1-2H3,(H,32,35)(H2,37,38,39)/t13-/m0/s1 |
| InChIKey | DXBMAOOKJQTARM-ZDUSSCGKSA-N |
| XLogP | 4.89 |
| TPSA | 128.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|