About 1-(8-oxa-3,10-diazabicyclo[4.3.1]decan-10-yl)ethanone
1-(8-oxa-3,10-diazabicyclo[4.3.1]decan-10-yl)ethanone (PubChem CID 146602397) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is 1-(8-oxa-3,10-diazabicyclo[4.3.1]decan-10-yl)ethanone.
Analyze 1-(8-oxa-3,10-diazabicyclo[4.3.1]decan-10-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(8-oxa-3,10-diazabicyclo[4.3.1]decan-10-yl)ethanone?
The IUPAC name of 1-(8-oxa-3,10-diazabicyclo[4.3.1]decan-10-yl)ethanone (CID 146602397) is 1-(8-oxa-3,10-diazabicyclo[4.3.1]decan-10-yl)ethanone.
What is the SMILES notation for 1-(8-oxa-3,10-diazabicyclo[4.3.1]decan-10-yl)ethanone?
The canonical SMILES for 1-(8-oxa-3,10-diazabicyclo[4.3.1]decan-10-yl)ethanone is CC(=O)N1C2CCNCC1COC2.
What is the InChIKey of 1-(8-oxa-3,10-diazabicyclo[4.3.1]decan-10-yl)ethanone?
The InChIKey is QTCVKZNXOYDIDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O2/c1-7(12)11-8-2-3-10-4-9(11)6-13-5-8/h8-10H,2-6H2,1H3.
What are the key properties of 1-(8-oxa-3,10-diazabicyclo[4.3.1]decan-10-yl)ethanone?
1-(8-oxa-3,10-diazabicyclo[4.3.1]decan-10-yl)ethanone has a molecular weight of 184.24 g/mol, XLogP of -0.40, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(8-oxa-3,10-diazabicyclo[4.3.1]decan-10-yl)ethanone is sourced from PubChem (CID 146602397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).