C18H31N2O2P — CID 146602524
1-[2,2-dimethylpropoxy(propan-2-yl)phosphoryl]-4-phenylpiperazine (PubChem CID 146602524) has the molecular formula C18H31N2O2P and a molecular weight of 338.43 g/mol. Its IUPAC name is 1-[2,2-dimethylpropoxy(propan-2-yl)phosphoryl]-4-phenylpiperazine.
| Compound Name | 1-[2,2-dimethylpropoxy(propan-2-yl)phosphoryl]-4-phenylpiperazine |
|---|---|
| PubChem CID | 146602524 |
| Molecular Formula | C18H31N2O2P |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 1-[2,2-dimethylpropoxy(propan-2-yl)phosphoryl]-4-phenylpiperazine |
| SMILES | CC(C)P(=O)(OCC(C)(C)C)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H31N2O2P/c1-16(2)23(21,22-15-18(3,4)5)20-13-11-19(12-14-20)17-9-7-6-8-10-17/h6-10,16H,11-15H2,1-5H3 |
| InChIKey | TXWWKSWUCFNBDY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|