C18H23N5O3S — CID 146603323
N-[[4-(N-acetyl-S-aminosulfonimidoyl)phenyl]methyl]-3-(3-but-3-ynyldiazirin-3-yl)-N-methylpropanamide (PubChem CID 146603323) has the molecular formula C18H23N5O3S and a molecular weight of 389.48 g/mol. Its IUPAC name is N-[[4-(N-acetyl-S-aminosulfonimidoyl)phenyl]methyl]-3-(3-but-3-ynyldiazirin-3-yl)-N-methylpropanamide.
| Compound Name | N-[[4-(N-acetyl-S-aminosulfonimidoyl)phenyl]methyl]-3-(3-but-3-ynyldiazirin-3-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 146603323 |
| Molecular Formula | C18H23N5O3S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | N-[[4-(N-acetyl-S-aminosulfonimidoyl)phenyl]methyl]-3-(3-but-3-ynyldiazirin-3-yl)-N-methylpropanamide |
| SMILES | C#CCCC1(CCC(=O)N(C)Cc2ccc(S(N)(=O)=NC(C)=O)cc2)N=N1 |
| InChI | InChI=1S/C18H23N5O3S/c1-4-5-11-18(21-22-18)12-10-17(25)23(3)13-15-6-8-16(9-7-15)27(19,26)20-14(2)24/h1,6-9H,5,10-13H2,2-3H3,(H2,19,20,24,26) |
| InChIKey | ILEDWRQVKLMFNC-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 117.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|