C27H43N5O4S2Si — CID 160538796
N-[[4-[S-amino-N-[tert-butyl(dimethyl)silyl]sulfonimidoyl]phenyl]methyl]-N-methylpent-4-ynamide;4-(methylaminomethyl)benzenesulfonamide (PubChem CID 160538796) has the molecular formula C27H43N5O4S2Si and a molecular weight of 593.89 g/mol. Its IUPAC name is N-[[4-[S-amino-N-[tert-butyl(dimethyl)silyl]sulfonimidoyl]phenyl]methyl]-N-methylpent-4-ynamide;4-(methylaminomethyl)benzenesulfonamide.
| Compound Name | N-[[4-[S-amino-N-[tert-butyl(dimethyl)silyl]sulfonimidoyl]phenyl]methyl]-N-methylpent-4-ynamide;4-(methylaminomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 160538796 |
| Molecular Formula | C27H43N5O4S2Si |
| Molecular Weight | 593.89 g/mol |
| Exact Mass | 593.25 |
| IUPAC Name | N-[[4-[S-amino-N-[tert-butyl(dimethyl)silyl]sulfonimidoyl]phenyl]methyl]-N-methylpent-4-ynamide;4-(methylaminomethyl)benzenesulfonamide |
| SMILES | C#CCCC(=O)N(C)Cc1ccc(S(N)(=O)=N[Si](C)(C)C(C)(C)C)cc1.CNCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C19H31N3O2SSi.C8H12N2O2S/c1-8-9-10-18(23)22(5)15-16-11-13-17(14-12-16)25(20,24)21-26(6,7)19(2,3)4;1-10-6-7-2-4-8(5-3-7)13(9,11)12/h1,11-14H,9-10,15H2,2-7H3,(H2,20,21,24);2-5,10H,6H2,1H3,(H2,9,11,12) |
| InChIKey | QWMQRNYDFLKBAO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.89 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|