C15H27N3O2SSi — CID 167348197
3-[S-amino-N-[tert-butyl(dimethyl)silyl]sulfonimidoyl]-N,N-dimethylbenzamide (PubChem CID 167348197) has the molecular formula C15H27N3O2SSi and a molecular weight of 341.55 g/mol. Its IUPAC name is 3-[S-amino-N-[tert-butyl(dimethyl)silyl]sulfonimidoyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[S-amino-N-[tert-butyl(dimethyl)silyl]sulfonimidoyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 167348197 |
| Molecular Formula | C15H27N3O2SSi |
| Molecular Weight | 341.55 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 3-[S-amino-N-[tert-butyl(dimethyl)silyl]sulfonimidoyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(S(N)(=O)=N[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C15H27N3O2SSi/c1-15(2,3)22(6,7)17-21(16,20)13-10-8-9-12(11-13)14(19)18(4)5/h8-11H,1-7H3,(H2,16,17,20) |
| InChIKey | STTKMJOIIAUFCU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.55 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|