C18H25N3O4S — CID 77089358
N,N-dimethyl-3-[3-(2-oxopyrrolidin-1-yl)piperidin-1-yl]sulfonylbenzamide (PubChem CID 77089358) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is N,N-dimethyl-3-[3-(2-oxopyrrolidin-1-yl)piperidin-1-yl]sulfonylbenzamide.
| Compound Name | N,N-dimethyl-3-[3-(2-oxopyrrolidin-1-yl)piperidin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 77089358 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N,N-dimethyl-3-[3-(2-oxopyrrolidin-1-yl)piperidin-1-yl]sulfonylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(S(=O)(=O)N2CCCC(N3CCCC3=O)C2)c1 |
| InChI | InChI=1S/C18H25N3O4S/c1-19(2)18(23)14-6-3-8-16(12-14)26(24,25)20-10-4-7-15(13-20)21-11-5-9-17(21)22/h3,6,8,12,15H,4-5,7,9-11,13H2,1-2H3 |
| InChIKey | XUMKXVIYCUIGMW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |