C15H13Cl2NO4S — CID 146604660
2,4-dichloro-6-[(5-methoxy-2,3-dihydroindol-1-yl)sulfonyl]phenol (PubChem CID 146604660) has the molecular formula C15H13Cl2NO4S and a molecular weight of 374.25 g/mol. Its IUPAC name is 2,4-dichloro-6-[(5-methoxy-2,3-dihydroindol-1-yl)sulfonyl]phenol.
| Compound Name | 2,4-dichloro-6-[(5-methoxy-2,3-dihydroindol-1-yl)sulfonyl]phenol |
|---|---|
| PubChem CID | 146604660 |
| Molecular Formula | C15H13Cl2NO4S |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 372.99 |
| IUPAC Name | 2,4-dichloro-6-[(5-methoxy-2,3-dihydroindol-1-yl)sulfonyl]phenol |
| SMILES | COc1ccc2c(c1)CCN2S(=O)(=O)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C15H13Cl2NO4S/c1-22-11-2-3-13-9(6-11)4-5-18(13)23(20,21)14-8-10(16)7-12(17)15(14)19/h2-3,6-8,19H,4-5H2,1H3 |
| InChIKey | UEJXAMGQQSTWNE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|