C18H17Cl2NO4S — CID 146604362
2,4-dichloro-6-spiro[2H-indole-3,4'-oxane]-1-ylsulfonylphenol (PubChem CID 146604362) has the molecular formula C18H17Cl2NO4S and a molecular weight of 414.31 g/mol. Its IUPAC name is 2,4-dichloro-6-spiro[2H-indole-3,4'-oxane]-1-ylsulfonylphenol.
| Compound Name | 2,4-dichloro-6-spiro[2H-indole-3,4'-oxane]-1-ylsulfonylphenol |
|---|---|
| PubChem CID | 146604362 |
| Molecular Formula | C18H17Cl2NO4S |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | 2,4-dichloro-6-spiro[2H-indole-3,4'-oxane]-1-ylsulfonylphenol |
| SMILES | O=S(=O)(c1cc(Cl)cc(Cl)c1O)N1CC2(CCOCC2)c2ccccc21 |
| InChI | InChI=1S/C18H17Cl2NO4S/c19-12-9-14(20)17(22)16(10-12)26(23,24)21-11-18(5-7-25-8-6-18)13-3-1-2-4-15(13)21/h1-4,9-10,22H,5-8,11H2 |
| InChIKey | KHIMPDLOBKGGHE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_A(43)', 'substructure': 'N/A'} |
|---|