C24H28N4O3 — CID 146609635
(E)-N-[(7-amino-2-methyl-1-benzofuran-3-yl)methyl]-N-methyl-3-[6-(methylamino)-5-(4-oxobutyl)-3-pyridinyl]prop-2-enamide (PubChem CID 146609635) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is (E)-N-[(7-amino-2-methyl-1-benzofuran-3-yl)methyl]-N-methyl-3-[6-(methylamino)-5-(4-oxobutyl)-3-pyridinyl]prop-2-enamide.
| Compound Name | (E)-N-[(7-amino-2-methyl-1-benzofuran-3-yl)methyl]-N-methyl-3-[6-(methylamino)-5-(4-oxobutyl)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 146609635 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | (E)-N-[(7-amino-2-methyl-1-benzofuran-3-yl)methyl]-N-methyl-3-[6-(methylamino)-5-(4-oxobutyl)-3-pyridinyl]prop-2-enamide |
| SMILES | CNc1ncc(/C=C/C(=O)N(C)Cc2c(C)oc3c(N)cccc23)cc1CCCC=O |
| InChI | InChI=1S/C24H28N4O3/c1-16-20(19-8-6-9-21(25)23(19)31-16)15-28(3)22(30)11-10-17-13-18(7-4-5-12-29)24(26-2)27-14-17/h6,8-14H,4-5,7,15,25H2,1-3H3,(H,26,27)/b11-10+ |
| InChIKey | QLVPTMHPQAMCGH-ZHACJKMWSA-N |
| XLogP | 3.95 |
| TPSA | 101.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|