C26H38N4O2 — CID 142942558
(E)-N-methyl-3-[6-(methylamino)-5-(5-oxopentyl)-3-pyridinyl]-N-[(Z,2E)-2-[1-(prop-2-enylamino)ethylidene]hex-4-enyl]prop-2-enamide (PubChem CID 142942558) has the molecular formula C26H38N4O2 and a molecular weight of 438.62 g/mol. Its IUPAC name is (E)-N-methyl-3-[6-(methylamino)-5-(5-oxopentyl)-3-pyridinyl]-N-[(Z,2E)-2-[1-(prop-2-enylamino)ethylidene]hex-4-enyl]prop-2-enamide.
| Compound Name | (E)-N-methyl-3-[6-(methylamino)-5-(5-oxopentyl)-3-pyridinyl]-N-[(Z,2E)-2-[1-(prop-2-enylamino)ethylidene]hex-4-enyl]prop-2-enamide |
|---|---|
| PubChem CID | 142942558 |
| Molecular Formula | C26H38N4O2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | (E)-N-methyl-3-[6-(methylamino)-5-(5-oxopentyl)-3-pyridinyl]-N-[(Z,2E)-2-[1-(prop-2-enylamino)ethylidene]hex-4-enyl]prop-2-enamide |
| SMILES | C=CCN/C(C)=C(\C/C=C\C)CN(C)C(=O)/C=C/c1cnc(NC)c(CCCCC=O)c1 |
| InChI | InChI=1S/C26H38N4O2/c1-6-8-12-24(21(3)28-16-7-2)20-30(5)25(32)15-14-22-18-23(13-10-9-11-17-31)26(27-4)29-19-22/h6-8,14-15,17-19,28H,2,9-13,16,20H2,1,3-5H3,(H,27,29)/b8-6-,15-14+,24-21+ |
| InChIKey | YSZRNXWJPJPAKD-GEWPSELYSA-N |
| XLogP | 4.52 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|