C27H29F2N2O5S2- — CID 146612771
CID 146612771 (PubChem CID 146612771) has the molecular formula C27H29F2N2O5S2- and a molecular weight of 563.67 g/mol.
| Compound Name | CID 146612771 |
|---|---|
| PubChem CID | 146612771 |
| Molecular Formula | C27H29F2N2O5S2- |
| Molecular Weight | 563.67 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | — |
| SMILES | CCCc1cc(-c2ccc3c(c2)OC(F)(F)O3)cc(CCC)c1CC(=O)/N=[S-](=O)/c1ncc(C(C)(C)O)s1 |
| InChI | InChI=1S/C27H29F2N2O5S2/c1-5-7-17-11-19(16-9-10-21-22(13-16)36-27(28,29)35-21)12-18(8-6-2)20(17)14-24(32)31-38(34)25-30-15-23(37-25)26(3,4)33/h9-13,15,33H,5-8,14H2,1-4H3/q-1 |
| InChIKey | BBEFBAMLUHFEIY-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.67 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|