C5H9F2N — CID 146616968
N-(2,2-difluoroethyl)prop-1-en-2-amine (PubChem CID 146616968) has the molecular formula C5H9F2N and a molecular weight of 121.13 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)prop-1-en-2-amine.
| Compound Name | N-(2,2-difluoroethyl)prop-1-en-2-amine |
|---|---|
| PubChem CID | 146616968 |
| Molecular Formula | C5H9F2N |
| Molecular Weight | 121.13 g/mol |
| Exact Mass | 121.07 |
| IUPAC Name | N-(2,2-difluoroethyl)prop-1-en-2-amine |
| SMILES | C=C(C)NCC(F)F |
| InChI | InChI=1S/C5H9F2N/c1-4(2)8-3-5(6)7/h5,8H,1,3H2,2H3 |
| InChIKey | IVEOJYJDAKVAHW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.13 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |