C21H25N5OS — CID 146617046
anilino-[1-[(4-ethyl-5-pyridin-2-yl-1,2,4-triazol-3-yl)sulfanyl]cyclopentyl]methanol (PubChem CID 146617046) has the molecular formula C21H25N5OS and a molecular weight of 395.53 g/mol. Its IUPAC name is anilino-[1-[(4-ethyl-5-pyridin-2-yl-1,2,4-triazol-3-yl)sulfanyl]cyclopentyl]methanol.
| Compound Name | anilino-[1-[(4-ethyl-5-pyridin-2-yl-1,2,4-triazol-3-yl)sulfanyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 146617046 |
| Molecular Formula | C21H25N5OS |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | anilino-[1-[(4-ethyl-5-pyridin-2-yl-1,2,4-triazol-3-yl)sulfanyl]cyclopentyl]methanol |
| SMILES | CCn1c(SC2(C(O)Nc3ccccc3)CCCC2)nnc1-c1ccccn1 |
| InChI | InChI=1S/C21H25N5OS/c1-2-26-18(17-12-6-9-15-22-17)24-25-20(26)28-21(13-7-8-14-21)19(27)23-16-10-4-3-5-11-16/h3-6,9-12,15,19,23,27H,2,7-8,13-14H2,1H3 |
| InChIKey | BRTZCABIXIWVHN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|