C20H23N5OS — CID 123153056
anilino-[1-[(4-ethyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]cyclobutyl]methanol (PubChem CID 123153056) has the molecular formula C20H23N5OS and a molecular weight of 381.51 g/mol. Its IUPAC name is anilino-[1-[(4-ethyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]cyclobutyl]methanol.
| Compound Name | anilino-[1-[(4-ethyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]cyclobutyl]methanol |
|---|---|
| PubChem CID | 123153056 |
| Molecular Formula | C20H23N5OS |
| Molecular Weight | 381.51 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | anilino-[1-[(4-ethyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]cyclobutyl]methanol |
| SMILES | CCn1c(SC2(C(O)Nc3ccccc3)CCC2)nnc1-c1cccnc1 |
| InChI | InChI=1S/C20H23N5OS/c1-2-25-17(15-8-6-13-21-14-15)23-24-19(25)27-20(11-7-12-20)18(26)22-16-9-4-3-5-10-16/h3-6,8-10,13-14,18,22,26H,2,7,11-12H2,1H3 |
| InChIKey | BERTZGUWMBSMAC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|