C15H18N2S — CID 146619028
N-(cyclopenta-1,3-diene-1-carboximidoyl)-N-[(2-methylcyclohexa-1,3-dien-1-yl)methyl]methanethioamide (PubChem CID 146619028) has the molecular formula C15H18N2S and a molecular weight of 258.39 g/mol. Its IUPAC name is N-(cyclopenta-1,3-diene-1-carboximidoyl)-N-[(2-methylcyclohexa-1,3-dien-1-yl)methyl]methanethioamide.
| Compound Name | N-(cyclopenta-1,3-diene-1-carboximidoyl)-N-[(2-methylcyclohexa-1,3-dien-1-yl)methyl]methanethioamide |
|---|---|
| PubChem CID | 146619028 |
| Molecular Formula | C15H18N2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | N-(cyclopenta-1,3-diene-1-carboximidoyl)-N-[(2-methylcyclohexa-1,3-dien-1-yl)methyl]methanethioamide |
| SMILES | [H]/N=C(\C1=CC=CC1)N(C=S)CC1=C(C)C=CCC1 |
| InChI | InChI=1S/C15H18N2S/c1-12-6-2-3-9-14(12)10-17(11-18)15(16)13-7-4-5-8-13/h2,4-7,11,16H,3,8-10H2,1H3/b16-15+ |
| InChIKey | BKUSCVVYQAKMLU-FOCLMDBBSA-N |
| XLogP | 3.78 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|