C14H20N2O4 — CID 146619190
(1R,8R,10S)-10-tert-butyl-8-hydroxy-6-methyl-12-oxa-2,4-diazatricyclo[7.2.1.02,7]dodec-6-ene-3,5-dione (PubChem CID 146619190) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is (1R,8R,10S)-10-tert-butyl-8-hydroxy-6-methyl-12-oxa-2,4-diazatricyclo[7.2.1.02,7]dodec-6-ene-3,5-dione.
| Compound Name | (1R,8R,10S)-10-tert-butyl-8-hydroxy-6-methyl-12-oxa-2,4-diazatricyclo[7.2.1.02,7]dodec-6-ene-3,5-dione |
|---|---|
| PubChem CID | 146619190 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | (1R,8R,10S)-10-tert-butyl-8-hydroxy-6-methyl-12-oxa-2,4-diazatricyclo[7.2.1.02,7]dodec-6-ene-3,5-dione |
| SMILES | Cc1c2n(c(=O)[nH]c1=O)[C@H]1C[C@@H](C(C)(C)C)C(O1)[C@@H]2O |
| InChI | InChI=1S/C14H20N2O4/c1-6-9-10(17)11-7(14(2,3)4)5-8(20-11)16(9)13(19)15-12(6)18/h7-8,10-11,17H,5H2,1-4H3,(H,15,18,19)/t7-,8-,10-,11?/m1/s1 |
| InChIKey | OANDMUAERZQZIL-SDZBQPJDSA-N |
| XLogP | 0.84 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |