C16H24N2O6P- — CID 153493659
[(E)-2-[(2S,5R)-3-tert-butyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]prop-1-enyl]-hydroxyphosphinate (PubChem CID 153493659) has the molecular formula C16H24N2O6P- and a molecular weight of 371.35 g/mol. Its IUPAC name is [(E)-2-[(2S,5R)-3-tert-butyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]prop-1-enyl]-hydroxyphosphinate.
| Compound Name | [(E)-2-[(2S,5R)-3-tert-butyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]prop-1-enyl]-hydroxyphosphinate |
|---|---|
| PubChem CID | 153493659 |
| Molecular Formula | C16H24N2O6P- |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | [(E)-2-[(2S,5R)-3-tert-butyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]prop-1-enyl]-hydroxyphosphinate |
| SMILES | C/C(=C\P(=O)([O-])O)[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)CC1C(C)(C)C |
| InChI | InChI=1S/C16H25N2O6P/c1-9-7-18(15(20)17-14(9)19)12-6-11(16(3,4)5)13(24-12)10(2)8-25(21,22)23/h7-8,11-13H,6H2,1-5H3,(H,17,19,20)(H2,21,22,23)/p-1/b10-8+/t11?,12-,13-/m1/s1 |
| InChIKey | SLQJUSZUFTYYHU-ZUDYWFQLSA-M |
| XLogP | 1.24 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|