C16H23N2O6P — CID 146869382
[(2S,5R)-3-tert-butyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-ethynylphosphinic acid (PubChem CID 146869382) has the molecular formula C16H23N2O6P and a molecular weight of 370.34 g/mol. Its IUPAC name is [(2S,5R)-3-tert-butyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-ethynylphosphinic acid.
| Compound Name | [(2S,5R)-3-tert-butyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-ethynylphosphinic acid |
|---|---|
| PubChem CID | 146869382 |
| Molecular Formula | C16H23N2O6P |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | [(2S,5R)-3-tert-butyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-ethynylphosphinic acid |
| SMILES | C#CP(=O)(O)OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)CC1C(C)(C)C |
| InChI | InChI=1S/C16H23N2O6P/c1-6-25(21,22)23-9-12-11(16(3,4)5)7-13(24-12)18-8-10(2)14(19)17-15(18)20/h1,8,11-13H,7,9H2,2-5H3,(H,21,22)(H,17,19,20)/t11?,12-,13-/m1/s1 |
| InChIKey | SNNMOXRFEVKRHW-VFRRUGBOSA-N |
| XLogP | 1.59 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|