C25H21N7O — CID 146621414
N-(3-aminophenyl)-4-methyl-3-[(2-pyridin-3-yl-5H-pyrrolo[3,2-d]pyrimidin-4-yl)amino]benzamide (PubChem CID 146621414) has the molecular formula C25H21N7O and a molecular weight of 435.49 g/mol. Its IUPAC name is N-(3-aminophenyl)-4-methyl-3-[(2-pyridin-3-yl-5H-pyrrolo[3,2-d]pyrimidin-4-yl)amino]benzamide.
| Compound Name | N-(3-aminophenyl)-4-methyl-3-[(2-pyridin-3-yl-5H-pyrrolo[3,2-d]pyrimidin-4-yl)amino]benzamide |
|---|---|
| PubChem CID | 146621414 |
| Molecular Formula | C25H21N7O |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | N-(3-aminophenyl)-4-methyl-3-[(2-pyridin-3-yl-5H-pyrrolo[3,2-d]pyrimidin-4-yl)amino]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(N)c2)cc1Nc1nc(-c2cccnc2)nc2cc[nH]c12 |
| InChI | InChI=1S/C25H21N7O/c1-15-7-8-16(25(33)29-19-6-2-5-18(26)13-19)12-21(15)31-24-22-20(9-11-28-22)30-23(32-24)17-4-3-10-27-14-17/h2-14,28H,26H2,1H3,(H,29,33)(H,30,31,32) |
| InChIKey | FPKFFYRWULOLAE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|