C28H40N6O6 — CID 146622623
1-[(E)-1-(2,4-dihydroxy-3-methylphenyl)propylideneamino]-3-[6-[[(E)-1-(2,4-dihydroxy-3-methylphenyl)propylideneamino]carbamoylamino]hexyl]urea (PubChem CID 146622623) has the molecular formula C28H40N6O6 and a molecular weight of 556.66 g/mol. Its IUPAC name is 1-[(E)-1-(2,4-dihydroxy-3-methylphenyl)propylideneamino]-3-[6-[[(E)-1-(2,4-dihydroxy-3-methylphenyl)propylideneamino]carbamoylamino]hexyl]urea.
| Compound Name | 1-[(E)-1-(2,4-dihydroxy-3-methylphenyl)propylideneamino]-3-[6-[[(E)-1-(2,4-dihydroxy-3-methylphenyl)propylideneamino]carbamoylamino]hexyl]urea |
|---|---|
| PubChem CID | 146622623 |
| Molecular Formula | C28H40N6O6 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | 1-[(E)-1-(2,4-dihydroxy-3-methylphenyl)propylideneamino]-3-[6-[[(E)-1-(2,4-dihydroxy-3-methylphenyl)propylideneamino]carbamoylamino]hexyl]urea |
| SMILES | CC/C(=N\NC(=O)NCCCCCCNC(=O)N/N=C(\CC)c1ccc(O)c(C)c1O)c1ccc(O)c(C)c1O |
| InChI | InChI=1S/C28H40N6O6/c1-5-21(19-11-13-23(35)17(3)25(19)37)31-33-27(39)29-15-9-7-8-10-16-30-28(40)34-32-22(6-2)20-12-14-24(36)18(4)26(20)38/h11-14,35-38H,5-10,15-16H2,1-4H3,(H2,29,33,39)(H2,30,34,40)/b31-21+,32-22+ |
| InChIKey | CMFRFGMJUHCHEO-RWRHWQIFSA-N |
| XLogP | 4.21 |
| TPSA | 187.90 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|