C18H21N3O3 — CID 146622142
1-benzyl-3-[(E)-1-(2,4-dihydroxy-3-methylphenyl)propylideneamino]urea (PubChem CID 146622142) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 1-benzyl-3-[(E)-1-(2,4-dihydroxy-3-methylphenyl)propylideneamino]urea.
| Compound Name | 1-benzyl-3-[(E)-1-(2,4-dihydroxy-3-methylphenyl)propylideneamino]urea |
|---|---|
| PubChem CID | 146622142 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-benzyl-3-[(E)-1-(2,4-dihydroxy-3-methylphenyl)propylideneamino]urea |
| SMILES | CC/C(=N\NC(=O)NCc1ccccc1)c1ccc(O)c(C)c1O |
| InChI | InChI=1S/C18H21N3O3/c1-3-15(14-9-10-16(22)12(2)17(14)23)20-21-18(24)19-11-13-7-5-4-6-8-13/h4-10,22-23H,3,11H2,1-2H3,(H2,19,21,24)/b20-15+ |
| InChIKey | USCUSPKPIKUHDR-HMMYKYKNSA-N |
| XLogP | 3.02 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|