C28H43N3O6 — CID 146623319
tert-butyl 2-[[(2S)-1-oxo-1-(propan-2-ylamino)-6-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexan-2-yl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 146623319) has the molecular formula C28H43N3O6 and a molecular weight of 517.67 g/mol. Its IUPAC name is tert-butyl 2-[[(2S)-1-oxo-1-(propan-2-ylamino)-6-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexan-2-yl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[(2S)-1-oxo-1-(propan-2-ylamino)-6-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexan-2-yl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 146623319 |
| Molecular Formula | C28H43N3O6 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.32 |
| IUPAC Name | tert-butyl 2-[[(2S)-1-oxo-1-(propan-2-ylamino)-6-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexan-2-yl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC1=C(C)C(=O)C(CCCC[C@H](NC(=O)C2CCCN2C(=O)OC(C)(C)C)C(=O)NC(C)C)=C(C)C1=O |
| InChI | InChI=1S/C28H43N3O6/c1-16(2)29-25(34)21(13-10-9-12-20-19(5)23(32)17(3)18(4)24(20)33)30-26(35)22-14-11-15-31(22)27(36)37-28(6,7)8/h16,21-22H,9-15H2,1-8H3,(H,29,34)(H,30,35)/t21-,22?/m0/s1 |
| InChIKey | YOLXGXSUWKADAA-HMTLIYDFSA-N |
| XLogP | 3.76 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|