C23H35N3O4 — CID 146623309
(2S)-N-[1-oxo-1-(propan-2-ylamino)-6-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 146623309) has the molecular formula C23H35N3O4 and a molecular weight of 417.55 g/mol. Its IUPAC name is (2S)-N-[1-oxo-1-(propan-2-ylamino)-6-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[1-oxo-1-(propan-2-ylamino)-6-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 146623309 |
| Molecular Formula | C23H35N3O4 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | (2S)-N-[1-oxo-1-(propan-2-ylamino)-6-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)hexan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | CC1=C(C)C(=O)C(CCCCC(NC(=O)[C@@H]2CCCN2)C(=O)NC(C)C)=C(C)C1=O |
| InChI | InChI=1S/C23H35N3O4/c1-13(2)25-23(30)19(26-22(29)18-11-8-12-24-18)10-7-6-9-17-16(5)20(27)14(3)15(4)21(17)28/h13,18-19,24H,6-12H2,1-5H3,(H,25,30)(H,26,29)/t18-,19?/m0/s1 |
| InChIKey | CQDXITSTQMRSDY-OYKVQYDMSA-N |
| XLogP | 2.11 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|