C16H22F2N4O3 — CID 146625416
tert-butyl 11,11-difluoro-13-methyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate (PubChem CID 146625416) has the molecular formula C16H22F2N4O3 and a molecular weight of 356.37 g/mol. Its IUPAC name is tert-butyl 11,11-difluoro-13-methyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate.
| Compound Name | tert-butyl 11,11-difluoro-13-methyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate |
|---|---|
| PubChem CID | 146625416 |
| Molecular Formula | C16H22F2N4O3 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | tert-butyl 11,11-difluoro-13-methyl-14-oxo-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylate |
| SMILES | CN1CC(F)(F)Cn2nc3c(c2C1=O)CN(C(=O)OC(C)(C)C)CC3 |
| InChI | InChI=1S/C16H22F2N4O3/c1-15(2,3)25-14(24)21-6-5-11-10(7-21)12-13(23)20(4)8-16(17,18)9-22(12)19-11/h5-9H2,1-4H3 |
| InChIKey | NCUKSUQMAWSYGM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |