C20H31N5O2 — CID 72887277
1,10-dimethyl-4-(1-methyl-4,5,6,7-tetrahydroindazole-3-carbonyl)-1,4,10-triazaspiro[5.6]dodecan-9-one (PubChem CID 72887277) has the molecular formula C20H31N5O2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 1,10-dimethyl-4-(1-methyl-4,5,6,7-tetrahydroindazole-3-carbonyl)-1,4,10-triazaspiro[5.6]dodecan-9-one.
| Compound Name | 1,10-dimethyl-4-(1-methyl-4,5,6,7-tetrahydroindazole-3-carbonyl)-1,4,10-triazaspiro[5.6]dodecan-9-one |
|---|---|
| PubChem CID | 72887277 |
| Molecular Formula | C20H31N5O2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | 1,10-dimethyl-4-(1-methyl-4,5,6,7-tetrahydroindazole-3-carbonyl)-1,4,10-triazaspiro[5.6]dodecan-9-one |
| SMILES | CN1CCC2(CCC1=O)CN(C(=O)c1nn(C)c3c1CCCC3)CCN2C |
| InChI | InChI=1S/C20H31N5O2/c1-22-11-10-20(9-8-17(22)26)14-25(13-12-23(20)2)19(27)18-15-6-4-5-7-16(15)24(3)21-18/h4-14H2,1-3H3 |
| InChIKey | AWNFSXHSFAJXDC-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |