C25H36F2N8O6 — CID 146626007
2-[2-[2-[2-(2-aminooxyethoxy)ethoxy]ethoxy]ethyl-[4-[2-(difluoromethyl)benzimidazol-1-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]ethanol (PubChem CID 146626007) has the molecular formula C25H36F2N8O6 and a molecular weight of 582.61 g/mol. Its IUPAC name is 2-[2-[2-[2-(2-aminooxyethoxy)ethoxy]ethoxy]ethyl-[4-[2-(difluoromethyl)benzimidazol-1-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]ethanol.
| Compound Name | 2-[2-[2-[2-(2-aminooxyethoxy)ethoxy]ethoxy]ethyl-[4-[2-(difluoromethyl)benzimidazol-1-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 146626007 |
| Molecular Formula | C25H36F2N8O6 |
| Molecular Weight | 582.61 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | 2-[2-[2-[2-(2-aminooxyethoxy)ethoxy]ethoxy]ethyl-[4-[2-(difluoromethyl)benzimidazol-1-yl]-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]ethanol |
| SMILES | NOCCOCCOCCOCCN(CCO)c1nc(N2CCOCC2)nc(-n2c(C(F)F)nc3ccccc32)n1 |
| InChI | InChI=1S/C25H36F2N8O6/c26-21(27)22-29-19-3-1-2-4-20(19)35(22)25-31-23(30-24(32-25)34-7-10-37-11-8-34)33(5-9-36)6-12-38-13-14-39-15-16-40-17-18-41-28/h1-4,21,36H,5-18,28H2 |
| InChIKey | WBUJXSQNOORSEW-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 155.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.61 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|