C24H48N2O2 — CID 146626547
N-(4-ethyl-4-methyl-3-oxooctan-2-yl)-3-methyl-2-(3-methylheptan-3-ylamino)butanamide (PubChem CID 146626547) has the molecular formula C24H48N2O2 and a molecular weight of 396.66 g/mol. Its IUPAC name is N-(4-ethyl-4-methyl-3-oxooctan-2-yl)-3-methyl-2-(3-methylheptan-3-ylamino)butanamide.
| Compound Name | N-(4-ethyl-4-methyl-3-oxooctan-2-yl)-3-methyl-2-(3-methylheptan-3-ylamino)butanamide |
|---|---|
| PubChem CID | 146626547 |
| Molecular Formula | C24H48N2O2 |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 396.37 |
| IUPAC Name | N-(4-ethyl-4-methyl-3-oxooctan-2-yl)-3-methyl-2-(3-methylheptan-3-ylamino)butanamide |
| SMILES | CCCCC(C)(CC)NC(C(=O)NC(C)C(=O)C(C)(CC)CCCC)C(C)C |
| InChI | InChI=1S/C24H48N2O2/c1-10-14-16-23(8,12-3)21(27)19(7)25-22(28)20(18(5)6)26-24(9,13-4)17-15-11-2/h18-20,26H,10-17H2,1-9H3,(H,25,28) |
| InChIKey | ZZEXCKNXXSXTOH-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |