C10H7Cl2NO2 — CID 146626645
1-(3,3-dichloropropa-1,2-dienyl)-2-methyl-3-nitrobenzene (PubChem CID 146626645) has the molecular formula C10H7Cl2NO2 and a molecular weight of 244.08 g/mol. Its IUPAC name is 1-(3,3-dichloropropa-1,2-dienyl)-2-methyl-3-nitrobenzene.
| Compound Name | 1-(3,3-dichloropropa-1,2-dienyl)-2-methyl-3-nitrobenzene |
|---|---|
| PubChem CID | 146626645 |
| Molecular Formula | C10H7Cl2NO2 |
| Molecular Weight | 244.08 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | 1-(3,3-dichloropropa-1,2-dienyl)-2-methyl-3-nitrobenzene |
| SMILES | Cc1c(C=C=C(Cl)Cl)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H7Cl2NO2/c1-7-8(5-6-10(11)12)3-2-4-9(7)13(14)15/h2-5H,1H3 |
| InChIKey | RVQBCMHEAYPRHI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.08 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|