C24H25N3O2 — CID 146627596
5-(1-benzylpyrazol-4-yl)-4-[(2E,4E)-5-methoxyhepta-2,4,6-trien-2-yl]-1-methylpyridin-2-one (PubChem CID 146627596) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 5-(1-benzylpyrazol-4-yl)-4-[(2E,4E)-5-methoxyhepta-2,4,6-trien-2-yl]-1-methylpyridin-2-one.
| Compound Name | 5-(1-benzylpyrazol-4-yl)-4-[(2E,4E)-5-methoxyhepta-2,4,6-trien-2-yl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 146627596 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 5-(1-benzylpyrazol-4-yl)-4-[(2E,4E)-5-methoxyhepta-2,4,6-trien-2-yl]-1-methylpyridin-2-one |
| SMILES | C=C/C(=C\C=C(/C)c1cc(=O)n(C)cc1-c1cnn(Cc2ccccc2)c1)OC |
| InChI | InChI=1S/C24H25N3O2/c1-5-21(29-4)12-11-18(2)22-13-24(28)26(3)17-23(22)20-14-25-27(16-20)15-19-9-7-6-8-10-19/h5-14,16-17H,1,15H2,2-4H3/b18-11+,21-12+ |
| InChIKey | SNYKNDFRJKPKDK-YOASITJSSA-N |
| XLogP | 4.42 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|