C17H16N3O3S- — CID 135355333
2-[4-(1-methyl-6-oxo-4-phenyl-3-pyridinyl)pyrazol-1-yl]ethanesulfinate (PubChem CID 135355333) has the molecular formula C17H16N3O3S- and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-[4-(1-methyl-6-oxo-4-phenyl-3-pyridinyl)pyrazol-1-yl]ethanesulfinate.
| Compound Name | 2-[4-(1-methyl-6-oxo-4-phenyl-3-pyridinyl)pyrazol-1-yl]ethanesulfinate |
|---|---|
| PubChem CID | 135355333 |
| Molecular Formula | C17H16N3O3S- |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 2-[4-(1-methyl-6-oxo-4-phenyl-3-pyridinyl)pyrazol-1-yl]ethanesulfinate |
| SMILES | Cn1cc(-c2cnn(CCS(=O)[O-])c2)c(-c2ccccc2)cc1=O |
| InChI | InChI=1S/C17H17N3O3S/c1-19-12-16(14-10-18-20(11-14)7-8-24(22)23)15(9-17(19)21)13-5-3-2-4-6-13/h2-6,9-12H,7-8H2,1H3,(H,22,23)/p-1 |
| InChIKey | VZHZIEJZZTZJTP-UHFFFAOYSA-M |
| XLogP | 1.79 |
| TPSA | 79.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|