C21H23N4O3S- — CID 135355454
[4-[4-(1-methyl-6-oxo-4-phenyl-3-pyridinyl)pyrazol-1-yl]piperidin-1-yl]methanesulfinate (PubChem CID 135355454) has the molecular formula C21H23N4O3S- and a molecular weight of 411.51 g/mol. Its IUPAC name is [4-[4-(1-methyl-6-oxo-4-phenyl-3-pyridinyl)pyrazol-1-yl]piperidin-1-yl]methanesulfinate.
| Compound Name | [4-[4-(1-methyl-6-oxo-4-phenyl-3-pyridinyl)pyrazol-1-yl]piperidin-1-yl]methanesulfinate |
|---|---|
| PubChem CID | 135355454 |
| Molecular Formula | C21H23N4O3S- |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | [4-[4-(1-methyl-6-oxo-4-phenyl-3-pyridinyl)pyrazol-1-yl]piperidin-1-yl]methanesulfinate |
| SMILES | Cn1cc(-c2cnn(C3CCN(CS(=O)[O-])CC3)c2)c(-c2ccccc2)cc1=O |
| InChI | InChI=1S/C21H24N4O3S/c1-23-14-20(19(11-21(23)26)16-5-3-2-4-6-16)17-12-22-25(13-17)18-7-9-24(10-8-18)15-29(27)28/h2-6,11-14,18H,7-10,15H2,1H3,(H,27,28)/p-1 |
| InChIKey | LKWNMYUUSZKZJB-UHFFFAOYSA-M |
| XLogP | 2.39 |
| TPSA | 83.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|