C21H16N4O3 — CID 146630092
5-hydroxy-N-[1-(pyridin-3-ylmethoxy)isoquinolin-6-yl]pyridine-2-carboxamide (PubChem CID 146630092) has the molecular formula C21H16N4O3 and a molecular weight of 372.38 g/mol. Its IUPAC name is 5-hydroxy-N-[1-(pyridin-3-ylmethoxy)isoquinolin-6-yl]pyridine-2-carboxamide.
| Compound Name | 5-hydroxy-N-[1-(pyridin-3-ylmethoxy)isoquinolin-6-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 146630092 |
| Molecular Formula | C21H16N4O3 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 5-hydroxy-N-[1-(pyridin-3-ylmethoxy)isoquinolin-6-yl]pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(OCc3cccnc3)nccc2c1)c1ccc(O)cn1 |
| InChI | InChI=1S/C21H16N4O3/c26-17-4-6-19(24-12-17)20(27)25-16-3-5-18-15(10-16)7-9-23-21(18)28-13-14-2-1-8-22-11-14/h1-12,26H,13H2,(H,25,27) |
| InChIKey | GNYVQEWQPGDPGE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |