C27H29FN4O2 — CID 146630145
4-[3-(4-ethoxyphenyl)-4-methyl-6-oxo-7-[[(3S)-pyrrolidin-3-yl]methylimino]-4,5-dihydro-1H-azepin-2-yl]-2-fluorobenzonitrile (PubChem CID 146630145) has the molecular formula C27H29FN4O2 and a molecular weight of 460.55 g/mol. Its IUPAC name is 4-[3-(4-ethoxyphenyl)-4-methyl-6-oxo-7-[[(3S)-pyrrolidin-3-yl]methylimino]-4,5-dihydro-1H-azepin-2-yl]-2-fluorobenzonitrile.
| Compound Name | 4-[3-(4-ethoxyphenyl)-4-methyl-6-oxo-7-[[(3S)-pyrrolidin-3-yl]methylimino]-4,5-dihydro-1H-azepin-2-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 146630145 |
| Molecular Formula | C27H29FN4O2 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | 4-[3-(4-ethoxyphenyl)-4-methyl-6-oxo-7-[[(3S)-pyrrolidin-3-yl]methylimino]-4,5-dihydro-1H-azepin-2-yl]-2-fluorobenzonitrile |
| SMILES | CCOc1ccc(C2=C(c3ccc(C#N)c(F)c3)N/C(=N/C[C@H]3CCNC3)C(=O)CC2C)cc1 |
| InChI | InChI=1S/C27H29FN4O2/c1-3-34-22-8-6-19(7-9-22)25-17(2)12-24(33)27(31-16-18-10-11-30-15-18)32-26(25)20-4-5-21(14-29)23(28)13-20/h4-9,13,17-18,30H,3,10-12,15-16H2,1-2H3,(H,31,32)/t17?,18-/m0/s1 |
| InChIKey | GVHNDJVQGUNWLQ-ZVAWYAOSSA-N |
| XLogP | 4.17 |
| TPSA | 86.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|