C26H27FN4O2 — CID 163864967
4-[3-(4-ethoxyphenyl)-4-methyl-5-oxo-6-[[(3S)-pyrrolidin-3-yl]methylimino]-1,4-dihydropyridin-2-yl]-2-fluorobenzonitrile (PubChem CID 163864967) has the molecular formula C26H27FN4O2 and a molecular weight of 446.53 g/mol. Its IUPAC name is 4-[3-(4-ethoxyphenyl)-4-methyl-5-oxo-6-[[(3S)-pyrrolidin-3-yl]methylimino]-1,4-dihydropyridin-2-yl]-2-fluorobenzonitrile.
| Compound Name | 4-[3-(4-ethoxyphenyl)-4-methyl-5-oxo-6-[[(3S)-pyrrolidin-3-yl]methylimino]-1,4-dihydropyridin-2-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 163864967 |
| Molecular Formula | C26H27FN4O2 |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 4-[3-(4-ethoxyphenyl)-4-methyl-5-oxo-6-[[(3S)-pyrrolidin-3-yl]methylimino]-1,4-dihydropyridin-2-yl]-2-fluorobenzonitrile |
| SMILES | CCOc1ccc(C2=C(c3ccc(C#N)c(F)c3)N/C(=N/C[C@H]3CCNC3)C(=O)C2C)cc1 |
| InChI | InChI=1S/C26H27FN4O2/c1-3-33-21-8-6-18(7-9-21)23-16(2)25(32)26(30-15-17-10-11-29-14-17)31-24(23)19-4-5-20(13-28)22(27)12-19/h4-9,12,16-17,29H,3,10-11,14-15H2,1-2H3,(H,30,31)/t16?,17-/m0/s1 |
| InChIKey | PFVXIWIIFQEAAU-DJNXLDHESA-N |
| XLogP | 3.78 |
| TPSA | 86.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|