C28H28FN3O — CID 146626794
4-[(4S)-6-(4-aminocyclohexyl)-3-(4-cyclopropylphenyl)-4-methyl-5-oxo-4H-pyridin-2-yl]-2-fluorobenzonitrile (PubChem CID 146626794) has the molecular formula C28H28FN3O and a molecular weight of 441.55 g/mol. Its IUPAC name is 4-[(4S)-6-(4-aminocyclohexyl)-3-(4-cyclopropylphenyl)-4-methyl-5-oxo-4H-pyridin-2-yl]-2-fluorobenzonitrile.
| Compound Name | 4-[(4S)-6-(4-aminocyclohexyl)-3-(4-cyclopropylphenyl)-4-methyl-5-oxo-4H-pyridin-2-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 146626794 |
| Molecular Formula | C28H28FN3O |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 4-[(4S)-6-(4-aminocyclohexyl)-3-(4-cyclopropylphenyl)-4-methyl-5-oxo-4H-pyridin-2-yl]-2-fluorobenzonitrile |
| SMILES | C[C@@H]1C(=O)C(C2CCC(N)CC2)=NC(c2ccc(C#N)c(F)c2)=C1c1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C28H28FN3O/c1-16-25(19-6-4-18(5-7-19)17-2-3-17)26(21-8-9-22(15-30)24(29)14-21)32-27(28(16)33)20-10-12-23(31)13-11-20/h4-9,14,16-17,20,23H,2-3,10-13,31H2,1H3/t16-,20?,23?/m0/s1 |
| InChIKey | CBDJLWUALASZBV-LIEIEOFGSA-N |
| XLogP | 5.62 |
| TPSA | 79.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|