C20H19ClFN3O2 — CID 146630610
4-chloro-2-[4-[2-[(dimethylamino)methyl]-3-methylimidazol-4-yl]phenoxy]-5-fluorobenzaldehyde (PubChem CID 146630610) has the molecular formula C20H19ClFN3O2 and a molecular weight of 387.84 g/mol. Its IUPAC name is 4-chloro-2-[4-[2-[(dimethylamino)methyl]-3-methylimidazol-4-yl]phenoxy]-5-fluorobenzaldehyde.
| Compound Name | 4-chloro-2-[4-[2-[(dimethylamino)methyl]-3-methylimidazol-4-yl]phenoxy]-5-fluorobenzaldehyde |
|---|---|
| PubChem CID | 146630610 |
| Molecular Formula | C20H19ClFN3O2 |
| Molecular Weight | 387.84 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 4-chloro-2-[4-[2-[(dimethylamino)methyl]-3-methylimidazol-4-yl]phenoxy]-5-fluorobenzaldehyde |
| SMILES | CN(C)Cc1ncc(-c2ccc(Oc3cc(Cl)c(F)cc3C=O)cc2)n1C |
| InChI | InChI=1S/C20H19ClFN3O2/c1-24(2)11-20-23-10-18(25(20)3)13-4-6-15(7-5-13)27-19-9-16(21)17(22)8-14(19)12-26/h4-10,12H,11H2,1-3H3 |
| InChIKey | NAWCFYGAJCTWHA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.84 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|