C56H40N8 — CID 146631116
4-N-[4-[4-(N-(4-benzo[e]benzotriazol-2-ylphenyl)anilino)phenyl]phenyl]-1-N-[(Z)-(2-iminonaphthalen-1-ylidene)amino]-4-N-phenylbenzene-1,4-diamine (PubChem CID 146631116) has the molecular formula C56H40N8 and a molecular weight of 824.99 g/mol. Its IUPAC name is 4-N-[4-[4-(N-(4-benzo[e]benzotriazol-2-ylphenyl)anilino)phenyl]phenyl]-1-N-[(Z)-(2-iminonaphthalen-1-ylidene)amino]-4-N-phenylbenzene-1,4-diamine.
| Compound Name | 4-N-[4-[4-(N-(4-benzo[e]benzotriazol-2-ylphenyl)anilino)phenyl]phenyl]-1-N-[(Z)-(2-iminonaphthalen-1-ylidene)amino]-4-N-phenylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 146631116 |
| Molecular Formula | C56H40N8 |
| Molecular Weight | 824.99 g/mol |
| Exact Mass | 824.34 |
| IUPAC Name | 4-N-[4-[4-(N-(4-benzo[e]benzotriazol-2-ylphenyl)anilino)phenyl]phenyl]-1-N-[(Z)-(2-iminonaphthalen-1-ylidene)amino]-4-N-phenylbenzene-1,4-diamine |
| SMILES | [H]/N=C1\C=Cc2ccccc2\C1=N\Nc1ccc(N(c2ccccc2)c2ccc(-c3ccc(N(c4ccccc4)c4ccc(-n5nc6ccc7ccccc7c6n5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C56H40N8/c57-53-37-23-41-11-7-9-17-51(41)55(53)59-58-43-25-31-48(32-26-43)62(44-13-3-1-4-14-44)46-27-19-39(20-28-46)40-21-29-47(30-22-40)63(45-15-5-2-6-16-45)49-33-35-50(36-34-49)64-60-54-38-24-42-12-8-10-18-52(42)56(54)61-64/h1-38,57-58H/b57-53+,59-55- |
| InChIKey | JWMNMFMDRDCSGT-RMVGXTPFSA-N |
| XLogP | 14.04 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.99 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|