C10H17F3 — CID 146632246
(3S)-1-propan-2-yl-3-(trifluoromethyl)cyclohexane (PubChem CID 146632246) has the molecular formula C10H17F3 and a molecular weight of 194.24 g/mol. Its IUPAC name is (3S)-1-propan-2-yl-3-(trifluoromethyl)cyclohexane.
| Compound Name | (3S)-1-propan-2-yl-3-(trifluoromethyl)cyclohexane |
|---|---|
| PubChem CID | 146632246 |
| Molecular Formula | C10H17F3 |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (3S)-1-propan-2-yl-3-(trifluoromethyl)cyclohexane |
| SMILES | CC(C)C1CCC[C@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C10H17F3/c1-7(2)8-4-3-5-9(6-8)10(11,12)13/h7-9H,3-6H2,1-2H3/t8?,9-/m0/s1 |
| InChIKey | MSYOBUIIBJAFRS-GKAPJAKFSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |