C10H13F3O4 — CID 22715203
2-[3-(trifluoromethyl)cyclohexyl]propanedioic acid (PubChem CID 22715203) has the molecular formula C10H13F3O4 and a molecular weight of 254.20 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)cyclohexyl]propanedioic acid.
| Compound Name | 2-[3-(trifluoromethyl)cyclohexyl]propanedioic acid |
|---|---|
| PubChem CID | 22715203 |
| Molecular Formula | C10H13F3O4 |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 2-[3-(trifluoromethyl)cyclohexyl]propanedioic acid |
| SMILES | O=C(O)C(C(=O)O)C1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C10H13F3O4/c11-10(12,13)6-3-1-2-5(4-6)7(8(14)15)9(16)17/h5-7H,1-4H2,(H,14,15)(H,16,17) |
| InChIKey | YXRBJVRPFMBSKF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|