C58H42N4 — CID 146633325
2-[4-[(3E,5E)-6-(9,9-diphenylfluoren-3-yl)hepta-1,3,5-trien-4-yl]phenyl]-4-phenyl-6-(4-pyridin-3-ylphenyl)-1,3,5-triazine (PubChem CID 146633325) has the molecular formula C58H42N4 and a molecular weight of 795.00 g/mol. Its IUPAC name is 2-[4-[(3E,5E)-6-(9,9-diphenylfluoren-3-yl)hepta-1,3,5-trien-4-yl]phenyl]-4-phenyl-6-(4-pyridin-3-ylphenyl)-1,3,5-triazine.
| Compound Name | 2-[4-[(3E,5E)-6-(9,9-diphenylfluoren-3-yl)hepta-1,3,5-trien-4-yl]phenyl]-4-phenyl-6-(4-pyridin-3-ylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 146633325 |
| Molecular Formula | C58H42N4 |
| Molecular Weight | 795.00 g/mol |
| Exact Mass | 794.34 |
| IUPAC Name | 2-[4-[(3E,5E)-6-(9,9-diphenylfluoren-3-yl)hepta-1,3,5-trien-4-yl]phenyl]-4-phenyl-6-(4-pyridin-3-ylphenyl)-1,3,5-triazine |
| SMILES | C=C/C=C(\C=C(/C)c1ccc2c(c1)-c1ccccc1C2(c1ccccc1)c1ccccc1)c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4cccnc4)cc3)n2)cc1 |
| InChI | InChI=1S/C58H42N4/c1-3-16-47(37-40(2)46-34-35-54-52(38-46)51-24-13-14-25-53(51)58(54,49-20-9-5-10-21-49)50-22-11-6-12-23-50)41-26-30-44(31-27-41)56-60-55(43-17-7-4-8-18-43)61-57(62-56)45-32-28-42(29-33-45)48-19-15-36-59-39-48/h3-39H,1H2,2H3/b40-37+,47-16+ |
| InChIKey | CLGYDVWKONEPIK-WIGRKMRFSA-N |
| XLogP | 13.97 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.00 |
| LogP ≤ 5 | 13.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|