C17H7Br2NO8 — CID 146635508
6,7-dibromo-8-(2-nitrobenzoyl)oxy-2-oxochromene-3-carboxylic acid (PubChem CID 146635508) has the molecular formula C17H7Br2NO8 and a molecular weight of 513.05 g/mol. Its IUPAC name is 6,7-dibromo-8-(2-nitrobenzoyl)oxy-2-oxochromene-3-carboxylic acid.
| Compound Name | 6,7-dibromo-8-(2-nitrobenzoyl)oxy-2-oxochromene-3-carboxylic acid |
|---|---|
| PubChem CID | 146635508 |
| Molecular Formula | C17H7Br2NO8 |
| Molecular Weight | 513.05 g/mol |
| Exact Mass | 510.85 |
| IUPAC Name | 6,7-dibromo-8-(2-nitrobenzoyl)oxy-2-oxochromene-3-carboxylic acid |
| SMILES | O=C(Oc1c(Br)c(Br)cc2cc(C(=O)O)c(=O)oc12)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H7Br2NO8/c18-10-6-7-5-9(15(21)22)17(24)27-13(7)14(12(10)19)28-16(23)8-3-1-2-4-11(8)20(25)26/h1-6H,(H,21,22) |
| InChIKey | OJXCAQUUYOFMLW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 136.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.05 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|