C29H16BrN3O9 — CID 171979283
2-[1-[(E)-[(6-bromo-2-oxochromene-3-carbonyl)hydrazinylidene]methyl]naphthalen-2-yl]oxycarbonyl-3-nitrobenzoic acid (PubChem CID 171979283) has the molecular formula C29H16BrN3O9 and a molecular weight of 630.36 g/mol. Its IUPAC name is 2-[1-[(E)-[(6-bromo-2-oxochromene-3-carbonyl)hydrazinylidene]methyl]naphthalen-2-yl]oxycarbonyl-3-nitrobenzoic acid.
| Compound Name | 2-[1-[(E)-[(6-bromo-2-oxochromene-3-carbonyl)hydrazinylidene]methyl]naphthalen-2-yl]oxycarbonyl-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 171979283 |
| Molecular Formula | C29H16BrN3O9 |
| Molecular Weight | 630.36 g/mol |
| Exact Mass | 629.01 |
| IUPAC Name | 2-[1-[(E)-[(6-bromo-2-oxochromene-3-carbonyl)hydrazinylidene]methyl]naphthalen-2-yl]oxycarbonyl-3-nitrobenzoic acid |
| SMILES | O=C(O)c1cccc([N+](=O)[O-])c1C(=O)Oc1ccc2ccccc2c1/C=N/NC(=O)c1cc2cc(Br)ccc2oc1=O |
| InChI | InChI=1S/C29H16BrN3O9/c30-17-9-11-23-16(12-17)13-20(28(37)41-23)26(34)32-31-14-21-18-5-2-1-4-15(18)8-10-24(21)42-29(38)25-19(27(35)36)6-3-7-22(25)33(39)40/h1-14H,(H,32,34)(H,35,36)/b31-14+ |
| InChIKey | OMEKZBZQYBDUKD-XAZZYMPDSA-N |
| XLogP | 5.30 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.36 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|