C26H18N2O4 — CID 177386306
N-[(E)-(2-methoxynaphthalen-1-yl)methylideneamino]-3-oxobenzo[f]chromene-2-carboxamide (PubChem CID 177386306) has the molecular formula C26H18N2O4 and a molecular weight of 422.44 g/mol. Its IUPAC name is N-[(E)-(2-methoxynaphthalen-1-yl)methylideneamino]-3-oxobenzo[f]chromene-2-carboxamide.
| Compound Name | N-[(E)-(2-methoxynaphthalen-1-yl)methylideneamino]-3-oxobenzo[f]chromene-2-carboxamide |
|---|---|
| PubChem CID | 177386306 |
| Molecular Formula | C26H18N2O4 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | N-[(E)-(2-methoxynaphthalen-1-yl)methylideneamino]-3-oxobenzo[f]chromene-2-carboxamide |
| SMILES | COc1ccc2ccccc2c1/C=N/NC(=O)c1cc2c(ccc3ccccc32)oc1=O |
| InChI | InChI=1S/C26H18N2O4/c1-31-23-12-10-17-7-3-5-9-19(17)22(23)15-27-28-25(29)21-14-20-18-8-4-2-6-16(18)11-13-24(20)32-26(21)30/h2-15H,1H3,(H,28,29)/b27-15+ |
| InChIKey | ODFGNBXVHAZIFC-JFLMPSFJSA-N |
| XLogP | 4.87 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|