C25H17N3O3 — CID 2311822
N-[(2-hydroxynaphthalen-1-yl)methylideneamino]-3-iminobenzo[f]chromene-2-carboxamide (PubChem CID 2311822) has the molecular formula C25H17N3O3 and a molecular weight of 407.43 g/mol. Its IUPAC name is N-[(2-hydroxynaphthalen-1-yl)methylideneamino]-3-iminobenzo[f]chromene-2-carboxamide.
| Compound Name | N-[(2-hydroxynaphthalen-1-yl)methylideneamino]-3-iminobenzo[f]chromene-2-carboxamide |
|---|---|
| PubChem CID | 2311822 |
| Molecular Formula | C25H17N3O3 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-[(2-hydroxynaphthalen-1-yl)methylideneamino]-3-iminobenzo[f]chromene-2-carboxamide |
| SMILES | [H]/N=c1\oc2ccc3ccccc3c2cc1C(=O)NN=Cc1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C25H17N3O3/c26-24-20(13-19-17-7-3-1-6-16(17)10-12-23(19)31-24)25(30)28-27-14-21-18-8-4-2-5-15(18)9-11-22(21)29/h1-14,26,29H,(H,28,30)/b26-24-,27-14? |
| InChIKey | ITOZLDQKAUADAN-DKWVWRBDSA-N |
| XLogP | 4.69 |
| TPSA | 98.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|