C17H13N3O2 — CID 5453496
N-[(Z)-benzylideneamino]-2-iminochromene-3-carboxamide (PubChem CID 5453496) has the molecular formula C17H13N3O2 and a molecular weight of 291.31 g/mol. Its IUPAC name is N-[(Z)-benzylideneamino]-2-iminochromene-3-carboxamide.
| Compound Name | N-[(Z)-benzylideneamino]-2-iminochromene-3-carboxamide |
|---|---|
| PubChem CID | 5453496 |
| Molecular Formula | C17H13N3O2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | N-[(Z)-benzylideneamino]-2-iminochromene-3-carboxamide |
| SMILES | [H]/N=c1\oc2ccccc2cc1C(=O)N/N=C\c1ccccc1 |
| InChI | InChI=1S/C17H13N3O2/c18-16-14(10-13-8-4-5-9-15(13)22-16)17(21)20-19-11-12-6-2-1-3-7-12/h1-11,18H,(H,20,21)/b18-16-,19-11- |
| InChIKey | OPHPDCSXLUQDSP-WHBZEJOESA-N |
| XLogP | 2.68 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|