C10H6F3NO2 — CID 146635855
4-phenyl-3-(trifluoromethoxy)-1,2-oxazole (PubChem CID 146635855) has the molecular formula C10H6F3NO2 and a molecular weight of 229.16 g/mol. Its IUPAC name is 4-phenyl-3-(trifluoromethoxy)-1,2-oxazole.
| Compound Name | 4-phenyl-3-(trifluoromethoxy)-1,2-oxazole |
|---|---|
| PubChem CID | 146635855 |
| Molecular Formula | C10H6F3NO2 |
| Molecular Weight | 229.16 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 4-phenyl-3-(trifluoromethoxy)-1,2-oxazole |
| SMILES | FC(F)(F)Oc1nocc1-c1ccccc1 |
| InChI | InChI=1S/C10H6F3NO2/c11-10(12,13)16-9-8(6-15-14-9)7-4-2-1-3-5-7/h1-6H |
| InChIKey | WYDITAOKLGADJL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.16 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |