C14H17N7O2S3 — CID 146636582
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(4-oxo-1-propan-2-yl-5H-pyrazolo[5,4-d]pyrimidin-6-yl)sulfanyl]acetamide (PubChem CID 146636582) has the molecular formula C14H17N7O2S3 and a molecular weight of 411.54 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(4-oxo-1-propan-2-yl-5H-pyrazolo[5,4-d]pyrimidin-6-yl)sulfanyl]acetamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(4-oxo-1-propan-2-yl-5H-pyrazolo[5,4-d]pyrimidin-6-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 146636582 |
| Molecular Formula | C14H17N7O2S3 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(4-oxo-1-propan-2-yl-5H-pyrazolo[5,4-d]pyrimidin-6-yl)sulfanyl]acetamide |
| SMILES | CCSc1nnc(NC(=O)CSc2nc3c(cnn3C(C)C)c(=O)[nH]2)s1 |
| InChI | InChI=1S/C14H17N7O2S3/c1-4-24-14-20-19-13(26-14)16-9(22)6-25-12-17-10-8(11(23)18-12)5-15-21(10)7(2)3/h5,7H,4,6H2,1-3H3,(H,16,19,22)(H,17,18,23) |
| InChIKey | BJTHTHCJDXKASG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|