C17H25NO8 — CID 146636941
2-[2-[(5S)-5-methyl-2,4-dioxo-9-oxa-3-azabicyclo[4.2.1]non-7-en-3-yl]ethoxy]ethyl 3-hydroxy-2-(hydroxymethyl)-2-methylpropanoate (PubChem CID 146636941) has the molecular formula C17H25NO8 and a molecular weight of 371.39 g/mol. Its IUPAC name is 2-[2-[(5S)-5-methyl-2,4-dioxo-9-oxa-3-azabicyclo[4.2.1]non-7-en-3-yl]ethoxy]ethyl 3-hydroxy-2-(hydroxymethyl)-2-methylpropanoate.
| Compound Name | 2-[2-[(5S)-5-methyl-2,4-dioxo-9-oxa-3-azabicyclo[4.2.1]non-7-en-3-yl]ethoxy]ethyl 3-hydroxy-2-(hydroxymethyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 146636941 |
| Molecular Formula | C17H25NO8 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 2-[2-[(5S)-5-methyl-2,4-dioxo-9-oxa-3-azabicyclo[4.2.1]non-7-en-3-yl]ethoxy]ethyl 3-hydroxy-2-(hydroxymethyl)-2-methylpropanoate |
| SMILES | C[C@@H]1C(=O)N(CCOCCOC(=O)C(C)(CO)CO)C(=O)C2C=CC1O2 |
| InChI | InChI=1S/C17H25NO8/c1-11-12-3-4-13(26-12)15(22)18(14(11)21)5-6-24-7-8-25-16(23)17(2,9-19)10-20/h3-4,11-13,19-20H,5-10H2,1-2H3/t11-,12?,13?/m0/s1 |
| InChIKey | DHPAAWUIKYMBBA-HIFPTAJRSA-N |
| XLogP | -1.13 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|